C23H21F2N5O2 — CID 134324607
N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 134324607) has the molecular formula C23H21F2N5O2 and a molecular weight of 437.45 g/mol. Its IUPAC name is N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 134324607 |
| Molecular Formula | C23H21F2N5O2 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(CNC(=O)c1ccc(=O)[nH]n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C23H21F2N5O2/c1-22(2)13-8-9-23(22,11-26-21(32)16-6-7-18(31)29-27-16)20-12(13)10-17(28-30-20)19-14(24)4-3-5-15(19)25/h3-7,10,13H,8-9,11H2,1-2H3,(H,26,32)(H,29,31)/t13-,23-/m0/s1 |
| InChIKey | JZCKEMFYNYSNJM-NPMABZOXSA-N |
| XLogP | 3.09 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |