C25H25F2N5O2 — CID 134324609
N-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-6-oxo-1H-pyrazine-3-carboxamide (PubChem CID 134324609) has the molecular formula C25H25F2N5O2 and a molecular weight of 465.50 g/mol. Its IUPAC name is N-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-6-oxo-1H-pyrazine-3-carboxamide.
| Compound Name | N-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-6-oxo-1H-pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 134324609 |
| Molecular Formula | C25H25F2N5O2 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-6-oxo-1H-pyrazine-3-carboxamide |
| SMILES | CCN(C[C@]12CC[C@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)C(=O)c1c[nH]c(=O)cn1 |
| InChI | InChI=1S/C25H25F2N5O2/c1-4-32(23(34)19-11-29-20(33)12-28-19)13-25-9-8-15(24(25,2)3)14-10-18(30-31-22(14)25)21-16(26)6-5-7-17(21)27/h5-7,10-12,15H,4,8-9,13H2,1-3H3,(H,29,33)/t15-,25-/m1/s1 |
| InChIKey | ABLHVLQGBMVNSC-SGANQWHYSA-N |
| XLogP | 3.82 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |