C25H33Cl3N6 — CID 134324862
1-[1-(2,4-dichlorophenyl)ethyl]-6-[(2S,4S,5R)-2,5-dimethyl-4-pyrrolidin-1-ylpiperidin-1-yl]-3-methylpyrazolo[3,4-b]pyrazine;hydrochloride (PubChem CID 134324862) has the molecular formula C25H33Cl3N6 and a molecular weight of 523.94 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-6-[(2S,4S,5R)-2,5-dimethyl-4-pyrrolidin-1-ylpiperidin-1-yl]-3-methylpyrazolo[3,4-b]pyrazine;hydrochloride.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-6-[(2S,4S,5R)-2,5-dimethyl-4-pyrrolidin-1-ylpiperidin-1-yl]-3-methylpyrazolo[3,4-b]pyrazine;hydrochloride |
|---|---|
| PubChem CID | 134324862 |
| Molecular Formula | C25H33Cl3N6 |
| Molecular Weight | 523.94 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-6-[(2S,4S,5R)-2,5-dimethyl-4-pyrrolidin-1-ylpiperidin-1-yl]-3-methylpyrazolo[3,4-b]pyrazine;hydrochloride |
| SMILES | Cc1nn(C(C)c2ccc(Cl)cc2Cl)c2nc(N3C[C@@H](C)[C@@H](N4CCCC4)C[C@@H]3C)cnc12.Cl |
| InChI | InChI=1S/C25H32Cl2N6.ClH/c1-15-14-32(16(2)11-22(15)31-9-5-6-10-31)23-13-28-24-17(3)30-33(25(24)29-23)18(4)20-8-7-19(26)12-21(20)27;/h7-8,12-13,15-16,18,22H,5-6,9-11,14H2,1-4H3;1H/t15-,16+,18?,22+;/m1./s1 |
| InChIKey | XZUIDJFNOLPMBL-CUXVMBDQSA-N |
| XLogP | 6.17 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.94 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |