(1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid

C7H12N2O2 — CID 134326519

IUPAC(1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid
SMILESO=C(O)N1C[C@H]2CC[C@@H](C1)N2
InChIInChI=1S/C7H12N2O2/c10-7(11)9-3-5-1-2-6(4-9)8-5/h5-6,8H,1-4H2,(H,10,11)/t5-,6+
InChIKeyJZVXLLNKARSSBL-OLQVQODUSA-N
MW156.18 g/mol
LogP0.10
Rot. Bonds

About (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid

(1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid (PubChem CID 134326519) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid.

Molecular Properties

Compound Name(1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid
PubChem CID134326519
Molecular FormulaC7H12N2O2
Molecular Weight156.18 g/mol
Exact Mass156.09
IUPAC Name(1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid
SMILESO=C(O)N1C[C@H]2CC[C@@H](C1)N2
InChIInChI=1S/C7H12N2O2/c10-7(11)9-3-5-1-2-6(4-9)8-5/h5-6,8H,1-4H2,(H,10,11)/t5-,6+
InChIKeyJZVXLLNKARSSBL-OLQVQODUSA-N
XLogP0.10
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.18
LogP ≤ 50.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid?
The IUPAC name of (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid (CID 134326519) is (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid.
What is the SMILES notation for (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid?
The canonical SMILES for (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid is O=C(O)N1C[C@H]2CC[C@@H](C1)N2.
What is the InChIKey of (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid?
The InChIKey is JZVXLLNKARSSBL-OLQVQODUSA-N. The full InChI is InChI=1S/C7H12N2O2/c10-7(11)9-3-5-1-2-6(4-9)8-5/h5-6,8H,1-4H2,(H,10,11)/t5-,6+.
What are the key properties of (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid?
(1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid has a molecular weight of 156.18 g/mol, XLogP of 0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-3,8-diazabicyclo[3.2.1]octane-3-carboxylic acid is sourced from PubChem (CID 134326519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).