C20H14F4N6O — CID 134326538
7-[3-[6-(difluoromethoxy)-3-pyridinyl]-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-6,8-difluoro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 134326538) has the molecular formula C20H14F4N6O and a molecular weight of 430.37 g/mol. Its IUPAC name is 7-[3-[6-(difluoromethoxy)-3-pyridinyl]-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-6,8-difluoro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-[3-[6-(difluoromethoxy)-3-pyridinyl]-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-6,8-difluoro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 134326538 |
| Molecular Formula | C20H14F4N6O |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 7-[3-[6-(difluoromethoxy)-3-pyridinyl]-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-6,8-difluoro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Fc1cc2c(c(F)c1-c1ncc3[nH]nc(-c4ccc(OC(F)F)nc4)c3n1)CNCC2 |
| InChI | InChI=1S/C20H14F4N6O/c21-12-5-9-3-4-25-7-11(9)16(22)15(12)19-27-8-13-18(28-19)17(30-29-13)10-1-2-14(26-6-10)31-20(23)24/h1-2,5-6,8,20,25H,3-4,7H2,(H,29,30) |
| InChIKey | YVHZXLSXJPOWBB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |