C34H39F3N6O5 — CID 134326580
[4-[2-(4-morpholin-4-ylbutoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-yl] 2,2,2-trifluoroacetate (PubChem CID 134326580) has the molecular formula C34H39F3N6O5 and a molecular weight of 668.72 g/mol. Its IUPAC name is [4-[2-(4-morpholin-4-ylbutoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[2-(4-morpholin-4-ylbutoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 134326580 |
| Molecular Formula | C34H39F3N6O5 |
| Molecular Weight | 668.72 g/mol |
| Exact Mass | 668.29 |
| IUPAC Name | [4-[2-(4-morpholin-4-ylbutoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-yl] 2,2,2-trifluoroacetate |
| SMILES | C=CC(=O)N1CCN(c2nc(OCCCCN3CCOCC3)nc3c2CCN(c2cc(OC(=O)C(F)(F)F)cc4ccccc24)C3)CC1 |
| InChI | InChI=1S/C34H39F3N6O5/c1-2-30(44)41-12-14-42(15-13-41)31-27-9-11-43(23-28(27)38-33(39-31)47-18-6-5-10-40-16-19-46-20-17-40)29-22-25(48-32(45)34(35,36)37)21-24-7-3-4-8-26(24)29/h2-4,7-8,21-22H,1,5-6,9-20,23H2 |
| InChIKey | LERCWFBAXGTIFW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.72 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|