C22H23FN4O5 — CID 134327180
4-[5-[1-[(4-fluorobenzoyl)amino]-2-hydroxyethyl]-1,2,4-oxadiazol-3-yl]-N-(3-methoxypropyl)benzamide (PubChem CID 134327180) has the molecular formula C22H23FN4O5 and a molecular weight of 442.45 g/mol. Its IUPAC name is 4-[5-[1-[(4-fluorobenzoyl)amino]-2-hydroxyethyl]-1,2,4-oxadiazol-3-yl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-[5-[1-[(4-fluorobenzoyl)amino]-2-hydroxyethyl]-1,2,4-oxadiazol-3-yl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 134327180 |
| Molecular Formula | C22H23FN4O5 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-[5-[1-[(4-fluorobenzoyl)amino]-2-hydroxyethyl]-1,2,4-oxadiazol-3-yl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccc(-c2noc(C(CO)NC(=O)c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C22H23FN4O5/c1-31-12-2-11-24-20(29)15-5-3-14(4-6-15)19-26-22(32-27-19)18(13-28)25-21(30)16-7-9-17(23)10-8-16/h3-10,18,28H,2,11-13H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | WCDSYLKMLIXIFI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|