C29H34N4O5 — CID 134327493
N-cyclohexyl-2-[(3R)-6-(methylcarbamoylamino)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-(2-phenylethyl)acetamide (PubChem CID 134327493) has the molecular formula C29H34N4O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is N-cyclohexyl-2-[(3R)-6-(methylcarbamoylamino)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | N-cyclohexyl-2-[(3R)-6-(methylcarbamoylamino)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 134327493 |
| Molecular Formula | C29H34N4O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-cyclohexyl-2-[(3R)-6-(methylcarbamoylamino)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-(2-phenylethyl)acetamide |
| SMILES | CNC(=O)Nc1ccc2c(c1)CC[C@@]21OC(=O)N(CC(=O)N(CCc2ccccc2)C2CCCCC2)C1=O |
| InChI | InChI=1S/C29H34N4O5/c1-30-27(36)31-22-12-13-24-21(18-22)14-16-29(24)26(35)33(28(37)38-29)19-25(34)32(23-10-6-3-7-11-23)17-15-20-8-4-2-5-9-20/h2,4-5,8-9,12-13,18,23H,3,6-7,10-11,14-17,19H2,1H3,(H2,30,31,36)/t29-/m1/s1 |
| InChIKey | PGTKCFMTCBMLEE-GDLZYMKVSA-N |
| XLogP | 3.96 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |