About 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine
5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine (PubChem CID 134327916) has the molecular formula C23H21F2N5
and a molecular weight of 405.45 g/mol. Its IUPAC name is 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine.
Molecular Properties
| Compound Name | 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine |
| PubChem CID | 134327916 |
| Molecular Formula | C23H21F2N5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine |
| SMILES | CN1CCN(c2ccc(-c3n[nH]c4ccc(-c5cccc(F)c5F)nc34)cc2)CC1 |
| InChI | InChI=1S/C23H21F2N5/c1-29-11-13-30(14-12-29)16-7-5-15(6-8-16)22-23-20(27-28-22)10-9-19(26-23)17-3-2-4-18(24)21(17)25/h2-10H,11-14H2,1H3,(H,27,28) |
| InChIKey | LUCMIFKWEZLJKS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine?
The IUPAC name of 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine (CID 134327916) is 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine.
What is the SMILES notation for 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine?
The canonical SMILES for 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine is CN1CCN(c2ccc(-c3n[nH]c4ccc(-c5cccc(F)c5F)nc34)cc2)CC1.
What is the InChIKey of 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine?
The InChIKey is LUCMIFKWEZLJKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F2N5/c1-29-11-13-30(14-12-29)16-7-5-15(6-8-16)22-23-20(27-28-22)10-9-19(26-23)17-3-2-4-18(24)21(17)25/h2-10H,11-14H2,1H3,(H,27,28).
What are the key properties of 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine?
5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine has a molecular weight of 405.45 g/mol, XLogP of 4.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-difluorophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[4,3-b]pyridine is sourced from PubChem (CID 134327916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).