C25H24F5N5O2S — CID 134328863
6-(7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-N-[6-(2-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide (PubChem CID 134328863) has the molecular formula C25H24F5N5O2S and a molecular weight of 553.56 g/mol. Its IUPAC name is 6-(7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-N-[6-(2-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide.
| Compound Name | 6-(7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-N-[6-(2-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134328863 |
| Molecular Formula | C25H24F5N5O2S |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 6-(7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-N-[6-(2-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide |
| SMILES | Cc1ccccc1-c1nc(NS(=O)(=O)c2cccc(N3CCN4CC(F)(F)CC4C3)n2)ccc1C(F)(F)F |
| InChI | InChI=1S/C25H24F5N5O2S/c1-16-5-2-3-6-18(16)23-19(25(28,29)30)9-10-20(31-23)33-38(36,37)22-8-4-7-21(32-22)34-11-12-35-15-24(26,27)13-17(35)14-34/h2-10,17H,11-15H2,1H3,(H,31,33) |
| InChIKey | FZLAFXNJZIHBRV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |