About 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one
4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one (PubChem CID 13433096) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one.
Molecular Properties
| Compound Name | 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one |
| PubChem CID | 13433096 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one |
| SMILES | Cc1cc(=O)n(C)c2c1CCO2 |
| InChI | InChI=1S/C9H11NO2/c1-6-5-8(11)10(2)9-7(6)3-4-12-9/h5H,3-4H2,1-2H3 |
| InChIKey | NSXYWWPZSMRFLZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one?
The IUPAC name of 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one (CID 13433096) is 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one.
What is the SMILES notation for 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one?
The canonical SMILES for 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one is Cc1cc(=O)n(C)c2c1CCO2.
What is the InChIKey of 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one?
The InChIKey is NSXYWWPZSMRFLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-5-8(11)10(2)9-7(6)3-4-12-9/h5H,3-4H2,1-2H3.
What are the key properties of 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one?
4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one has a molecular weight of 165.19 g/mol, XLogP of 0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-2,3-dihydrofuro[2,3-b]pyridin-6-one is sourced from PubChem (CID 13433096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).