C29H49NO — CID 134331006
(E,10R,13R,17R)-N-ethoxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine (PubChem CID 134331006) has the molecular formula C29H49NO and a molecular weight of 427.72 g/mol. Its IUPAC name is (E,10R,13R,17R)-N-ethoxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine.
| Compound Name | (E,10R,13R,17R)-N-ethoxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 134331006 |
| Molecular Formula | C29H49NO |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 427.38 |
| IUPAC Name | (E,10R,13R,17R)-N-ethoxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine |
| SMILES | CCO/N=C1\CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C29H49NO/c1-7-31-30-23-15-17-28(5)22(19-23)11-12-24-26-14-13-25(21(4)10-8-9-20(2)3)29(26,6)18-16-27(24)28/h11,20-21,24-27H,7-10,12-19H2,1-6H3/b30-23+/t21-,24?,25-,26?,27?,28+,29-/m1/s1 |
| InChIKey | OHQHEFINPUWJJJ-LFIJHCNVSA-N |
| XLogP | 8.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|