About 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one
8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one (PubChem CID 134331302) has the molecular formula C13H10N2O3
and a molecular weight of 242.23 g/mol. Its IUPAC name is 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one.
Molecular Properties
| Compound Name | 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one |
| PubChem CID | 134331302 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one |
| SMILES | O=c1[nH]c2cc(C(O)O)ccc2c2ccncc12 |
| InChI | InChI=1S/C13H10N2O3/c16-12-10-6-14-4-3-8(10)9-2-1-7(13(17)18)5-11(9)15-12/h1-6,13,17-18H,(H,15,16) |
| InChIKey | BYLXEZKAXGMYOU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one?
The IUPAC name of 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one (CID 134331302) is 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one.
What is the SMILES notation for 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one?
The canonical SMILES for 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one is O=c1[nH]c2cc(C(O)O)ccc2c2ccncc12.
What is the InChIKey of 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one?
The InChIKey is BYLXEZKAXGMYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3/c16-12-10-6-14-4-3-8(10)9-2-1-7(13(17)18)5-11(9)15-12/h1-6,13,17-18H,(H,15,16).
What are the key properties of 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one?
8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one has a molecular weight of 242.23 g/mol, XLogP of 1.06, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(dihydroxymethyl)-6H-benzo[c][2,7]naphthyridin-5-one is sourced from PubChem (CID 134331302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).