C30H36F4O3S — CID 134331428
2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfinic acid (PubChem CID 134331428) has the molecular formula C30H36F4O3S and a molecular weight of 552.67 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfinic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfinic acid |
|---|---|
| PubChem CID | 134331428 |
| Molecular Formula | C30H36F4O3S |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfinic acid |
| SMILES | O=S(O)c1c(F)c(F)c(Oc2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C30H36F4O3S/c31-24-26(33)30(38(35)36)27(34)25(32)29(24)37-28-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(28)20-14-8-3-9-15-20/h16-20H,1-15H2,(H,35,36) |
| InChIKey | VMHBRIHZEDVOBN-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|