C4H10N8O3 — CID 134331489
3,5,7-trinitroso-1,3,5,7-tetrazocan-1-amine (PubChem CID 134331489) has the molecular formula C4H10N8O3 and a molecular weight of 218.18 g/mol. Its IUPAC name is 3,5,7-trinitroso-1,3,5,7-tetrazocan-1-amine.
| Compound Name | 3,5,7-trinitroso-1,3,5,7-tetrazocan-1-amine |
|---|---|
| PubChem CID | 134331489 |
| Molecular Formula | C4H10N8O3 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3,5,7-trinitroso-1,3,5,7-tetrazocan-1-amine |
| SMILES | NN1CN(N=O)CN(N=O)CN(N=O)C1 |
| InChI | InChI=1S/C4H10N8O3/c5-9-1-10(6-13)3-12(8-15)4-11(2-9)7-14/h1-5H2 |
| InChIKey | QJJDDFLHNREPKQ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 127.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|