About (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene
(5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene (PubChem CID 134331547) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene.
Molecular Properties
| Compound Name | (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene |
| PubChem CID | 134331547 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene |
| SMILES | CC(C)(C)OC12C=CC(C1)C1CC/C=C\CCC12 |
| InChI | InChI=1S/C17H26O/c1-16(2,3)18-17-11-10-13(12-17)14-8-6-4-5-7-9-15(14)17/h4-5,10-11,13-15H,6-9,12H2,1-3H3/b5-4- |
| InChIKey | GUYSARCDGCPPHV-PLNGDYQASA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene?
The IUPAC name of (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene (CID 134331547) is (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene.
What is the SMILES notation for (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene?
The canonical SMILES for (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene is CC(C)(C)OC12C=CC(C1)C1CC/C=C\CCC12.
What is the InChIKey of (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene?
The InChIKey is GUYSARCDGCPPHV-PLNGDYQASA-N. The full InChI is InChI=1S/C17H26O/c1-16(2,3)18-17-11-10-13(12-17)14-8-6-4-5-7-9-15(14)17/h4-5,10-11,13-15H,6-9,12H2,1-3H3/b5-4-.
What are the key properties of (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene?
(5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene has a molecular weight of 246.39 g/mol, XLogP of 4.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-1-[(2-methylpropan-2-yl)oxy]tricyclo[8.2.1.02,9]trideca-5,11-diene is sourced from PubChem (CID 134331547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).