C13H19F3N2O — CID 134331554
4-[5-propan-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclohexan-1-ol (PubChem CID 134331554) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-[5-propan-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclohexan-1-ol.
| Compound Name | 4-[5-propan-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 134331554 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-[5-propan-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclohexan-1-ol |
| SMILES | CC(C)c1cc(C(F)(F)F)nn1C1CCC(O)CC1 |
| InChI | InChI=1S/C13H19F3N2O/c1-8(2)11-7-12(13(14,15)16)17-18(11)9-3-5-10(19)6-4-9/h7-10,19H,3-6H2,1-2H3 |
| InChIKey | INKKDYXMTDDESX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |