C18H25NO — CID 13433192
2-(3-butyl-2-prop-2-enylphenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 13433192) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-(3-butyl-2-prop-2-enylphenyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(3-butyl-2-prop-2-enylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 13433192 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-(3-butyl-2-prop-2-enylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | C=CCc1c(CCCC)cccc1C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C18H25NO/c1-5-7-10-14-11-8-12-16(15(14)9-6-2)17-19-18(3,4)13-20-17/h6,8,11-12H,2,5,7,9-10,13H2,1,3-4H3 |
| InChIKey | HFWIFRLYNLCSLS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|