About [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone
[2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone (PubChem CID 13433198) has the molecular formula C22H25NO2
and a molecular weight of 335.45 g/mol. Its IUPAC name is [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone |
| PubChem CID | 13433198 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone |
| SMILES | CCCCc1cccc(C2=NC(C)(C)CO2)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-4-5-10-16-13-9-14-18(21-23-22(2,3)15-25-21)19(16)20(24)17-11-7-6-8-12-17/h6-9,11-14H,4-5,10,15H2,1-3H3 |
| InChIKey | RYWVFZKEBJORLT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone?
The IUPAC name of [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone (CID 13433198) is [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone.
What is the SMILES notation for [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone?
The canonical SMILES for [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone is CCCCc1cccc(C2=NC(C)(C)CO2)c1C(=O)c1ccccc1.
What is the InChIKey of [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone?
The InChIKey is RYWVFZKEBJORLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO2/c1-4-5-10-16-13-9-14-18(21-23-22(2,3)15-25-21)19(16)20(24)17-11-7-6-8-12-17/h6-9,11-14H,4-5,10,15H2,1-3H3.
What are the key properties of [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone?
[2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone has a molecular weight of 335.45 g/mol, XLogP of 4.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-butyl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone is sourced from PubChem (CID 13433198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).