About [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone
[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone (PubChem CID 13433200) has the molecular formula C24H21NO2
and a molecular weight of 355.44 g/mol. Its IUPAC name is [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone |
| PubChem CID | 13433200 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone |
| SMILES | CC1(C)COC(c2cccc(-c3ccccc3)c2C(=O)c2ccccc2)=N1 |
| InChI | InChI=1S/C24H21NO2/c1-24(2)16-27-23(25-24)20-15-9-14-19(17-10-5-3-6-11-17)21(20)22(26)18-12-7-4-8-13-18/h3-15H,16H2,1-2H3 |
| InChIKey | VAPRZMUAQUQKEI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone?
The IUPAC name of [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone (CID 13433200) is [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone.
What is the SMILES notation for [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone?
The canonical SMILES for [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone is CC1(C)COC(c2cccc(-c3ccccc3)c2C(=O)c2ccccc2)=N1.
What is the InChIKey of [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone?
The InChIKey is VAPRZMUAQUQKEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21NO2/c1-24(2)16-27-23(25-24)20-15-9-14-19(17-10-5-3-6-11-17)21(20)22(26)18-12-7-4-8-13-18/h3-15H,16H2,1-2H3.
What are the key properties of [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone?
[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone has a molecular weight of 355.44 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-phenylphenyl]-phenylmethanone is sourced from PubChem (CID 13433200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).