About 3-(4-bromoanilino)-1,3-oxazolidin-2-one
3-(4-bromoanilino)-1,3-oxazolidin-2-one (PubChem CID 134332107) has the molecular formula C9H9BrN2O2
and a molecular weight of 257.09 g/mol. Its IUPAC name is 3-(4-bromoanilino)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-(4-bromoanilino)-1,3-oxazolidin-2-one |
| PubChem CID | 134332107 |
| Molecular Formula | C9H9BrN2O2 |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 3-(4-bromoanilino)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H9BrN2O2/c10-7-1-3-8(4-2-7)11-12-5-6-14-9(12)13/h1-4,11H,5-6H2 |
| InChIKey | MEFZKTMLXAZTKY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromoanilino)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromoanilino)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(4-bromoanilino)-1,3-oxazolidin-2-one (CID 134332107) is 3-(4-bromoanilino)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(4-bromoanilino)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(4-bromoanilino)-1,3-oxazolidin-2-one is O=C1OCCN1Nc1ccc(Br)cc1.
What is the InChIKey of 3-(4-bromoanilino)-1,3-oxazolidin-2-one?
The InChIKey is MEFZKTMLXAZTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O2/c10-7-1-3-8(4-2-7)11-12-5-6-14-9(12)13/h1-4,11H,5-6H2.
What are the key properties of 3-(4-bromoanilino)-1,3-oxazolidin-2-one?
3-(4-bromoanilino)-1,3-oxazolidin-2-one has a molecular weight of 257.09 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromoanilino)-1,3-oxazolidin-2-one is sourced from PubChem (CID 134332107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).