C23H24F7N5O3S — CID 134332838
1-(5-ethylthiophen-2-yl)-4,4,4-trifluoro-3-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-3-[[1-hydroxy-2-(2H-tetrazol-5-yl)ethyl]amino]butan-1-one (PubChem CID 134332838) has the molecular formula C23H24F7N5O3S and a molecular weight of 583.53 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-4,4,4-trifluoro-3-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-3-[[1-hydroxy-2-(2H-tetrazol-5-yl)ethyl]amino]butan-1-one.
| Compound Name | 1-(5-ethylthiophen-2-yl)-4,4,4-trifluoro-3-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-3-[[1-hydroxy-2-(2H-tetrazol-5-yl)ethyl]amino]butan-1-one |
|---|---|
| PubChem CID | 134332838 |
| Molecular Formula | C23H24F7N5O3S |
| Molecular Weight | 583.53 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-4,4,4-trifluoro-3-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-3-[[1-hydroxy-2-(2H-tetrazol-5-yl)ethyl]amino]butan-1-one |
| SMILES | CCc1ccc(C(=O)CC(NC(O)Cc2nn[nH]n2)(c2ccc(OCCCC(F)(F)F)cc2F)C(F)(F)F)s1 |
| InChI | InChI=1S/C23H24F7N5O3S/c1-2-14-5-7-18(39-14)17(36)12-21(23(28,29)30,31-20(37)11-19-32-34-35-33-19)15-6-4-13(10-16(15)24)38-9-3-8-22(25,26)27/h4-7,10,20,31,37H,2-3,8-9,11-12H2,1H3,(H,32,33,34,35) |
| InChIKey | FOMBRFZJAMZJKU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|