About 5-(4-methylhexan-2-yl)-1,2-thiazole
5-(4-methylhexan-2-yl)-1,2-thiazole (PubChem CID 134333456) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is 5-(4-methylhexan-2-yl)-1,2-thiazole.
Molecular Properties
| Compound Name | 5-(4-methylhexan-2-yl)-1,2-thiazole |
| PubChem CID | 134333456 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 5-(4-methylhexan-2-yl)-1,2-thiazole |
| SMILES | CCC(C)CC(C)c1ccns1 |
| InChI | InChI=1S/C10H17NS/c1-4-8(2)7-9(3)10-5-6-11-12-10/h5-6,8-9H,4,7H2,1-3H3 |
| InChIKey | VMZWKULEPUAODO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-methylhexan-2-yl)-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylhexan-2-yl)-1,2-thiazole?
The IUPAC name of 5-(4-methylhexan-2-yl)-1,2-thiazole (CID 134333456) is 5-(4-methylhexan-2-yl)-1,2-thiazole.
What is the SMILES notation for 5-(4-methylhexan-2-yl)-1,2-thiazole?
The canonical SMILES for 5-(4-methylhexan-2-yl)-1,2-thiazole is CCC(C)CC(C)c1ccns1.
What is the InChIKey of 5-(4-methylhexan-2-yl)-1,2-thiazole?
The InChIKey is VMZWKULEPUAODO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-4-8(2)7-9(3)10-5-6-11-12-10/h5-6,8-9H,4,7H2,1-3H3.
What are the key properties of 5-(4-methylhexan-2-yl)-1,2-thiazole?
5-(4-methylhexan-2-yl)-1,2-thiazole has a molecular weight of 183.32 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylhexan-2-yl)-1,2-thiazole is sourced from PubChem (CID 134333456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).