C14H22N4O3 — CID 134333641
N-[2-(2,4,5,9-tetramethyl-3,7-dioxo-1H-1,2,6-triazonin-6-yl)ethyl]acetamide (PubChem CID 134333641) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is N-[2-(2,4,5,9-tetramethyl-3,7-dioxo-1H-1,2,6-triazonin-6-yl)ethyl]acetamide.
| Compound Name | N-[2-(2,4,5,9-tetramethyl-3,7-dioxo-1H-1,2,6-triazonin-6-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 134333641 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[2-(2,4,5,9-tetramethyl-3,7-dioxo-1H-1,2,6-triazonin-6-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCn1c(C)c(C)c(=O)n(C)[nH]c(C)cc1=O |
| InChI | InChI=1S/C14H22N4O3/c1-9-8-13(20)18(7-6-15-12(4)19)11(3)10(2)14(21)17(5)16-9/h8,16H,6-7H2,1-5H3,(H,15,19)/b9-8-,11-10- |
| InChIKey | IBPSDNOPBZHEHU-XESWYYRISA-N |
| XLogP | 0.06 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |