About 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine
6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine (PubChem CID 134333967) has the molecular formula C10H16F2N2O
and a molecular weight of 218.25 g/mol. Its IUPAC name is 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine |
| PubChem CID | 134333967 |
| Molecular Formula | C10H16F2N2O |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine |
| SMILES | COC1=CC(CNCC(F)F)C(N)C=C1 |
| InChI | InChI=1S/C10H16F2N2O/c1-15-8-2-3-9(13)7(4-8)5-14-6-10(11)12/h2-4,7,9-10,14H,5-6,13H2,1H3 |
| InChIKey | HUWMJAXYFPHVSG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine?
The IUPAC name of 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine (CID 134333967) is 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine?
The canonical SMILES for 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine is COC1=CC(CNCC(F)F)C(N)C=C1.
What is the InChIKey of 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine?
The InChIKey is HUWMJAXYFPHVSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N2O/c1-15-8-2-3-9(13)7(4-8)5-14-6-10(11)12/h2-4,7,9-10,14H,5-6,13H2,1H3.
What are the key properties of 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine?
6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine has a molecular weight of 218.25 g/mol, XLogP of 0.88, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,2-difluoroethylamino)methyl]-4-methoxycyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 134333967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).