C24H23ClN6O3S — CID 134334049
4-[3-chloro-4-[(1-propan-2-ylpyrazol-4-yl)carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 134334049) has the molecular formula C24H23ClN6O3S and a molecular weight of 511.01 g/mol. Its IUPAC name is 4-[3-chloro-4-[(1-propan-2-ylpyrazol-4-yl)carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-[(1-propan-2-ylpyrazol-4-yl)carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 134334049 |
| Molecular Formula | C24H23ClN6O3S |
| Molecular Weight | 511.01 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 4-[3-chloro-4-[(1-propan-2-ylpyrazol-4-yl)carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=S)Nc4cnn(C(C)C)c4)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C24H23ClN6O3S/c1-13(2)31-12-14(11-28-31)29-24(35)30-19-5-4-15(8-18(19)25)34-21-6-7-27-20-10-22(33-3)17(23(26)32)9-16(20)21/h4-13H,1-3H3,(H2,26,32)(H2,29,30,35) |
| InChIKey | VGMDDPJDBJACGA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.01 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|