C30H22ClF3N4O5 — CID 134334065
4-[3-chloro-4-[[3,4-dioxo-2-[[(1E,3E,5Z)-3-(trifluoromethyl)cycloocta-1,3,5-trien-1-yl]amino]cyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 134334065) has the molecular formula C30H22ClF3N4O5 and a molecular weight of 610.98 g/mol. Its IUPAC name is 4-[3-chloro-4-[[3,4-dioxo-2-[[(1E,3E,5Z)-3-(trifluoromethyl)cycloocta-1,3,5-trien-1-yl]amino]cyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-[[3,4-dioxo-2-[[(1E,3E,5Z)-3-(trifluoromethyl)cycloocta-1,3,5-trien-1-yl]amino]cyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 134334065 |
| Molecular Formula | C30H22ClF3N4O5 |
| Molecular Weight | 610.98 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | 4-[3-chloro-4-[[3,4-dioxo-2-[[(1E,3E,5Z)-3-(trifluoromethyl)cycloocta-1,3,5-trien-1-yl]amino]cyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(Nc4c(N/C5=C/C(C(F)(F)F)=C\C=C/CC5)c(=O)c4=O)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C30H22ClF3N4O5/c1-42-24-14-22-18(13-19(24)29(35)41)23(9-10-36-22)43-17-7-8-21(20(31)12-17)38-26-25(27(39)28(26)40)37-16-6-4-2-3-5-15(11-16)30(32,33)34/h2-3,5,7-14,37-38H,4,6H2,1H3,(H2,35,41)/b3-2-,15-5+,16-11+ |
| InChIKey | ZSNAKNTULLDACU-ABWBQOFNSA-N |
| XLogP | 6.26 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.98 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|