About (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine
(3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine (PubChem CID 134334193) has the molecular formula C12H22ClNO
and a molecular weight of 231.77 g/mol. Its IUPAC name is (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine.
Molecular Properties
| Compound Name | (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine |
| PubChem CID | 134334193 |
| Molecular Formula | C12H22ClNO |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine |
| SMILES | C=C(/C=C(\CC)NC(CC)CCCl)OC |
| InChI | InChI=1S/C12H22ClNO/c1-5-11(7-8-13)14-12(6-2)9-10(3)15-4/h9,11,14H,3,5-8H2,1-2,4H3/b12-9+ |
| InChIKey | AJTFBSFRWBRGKS-FMIVXFBMSA-N |
| XLogP | 3.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine?
The IUPAC name of (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine (CID 134334193) is (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine.
What is the SMILES notation for (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine?
The canonical SMILES for (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine is C=C(/C=C(\CC)NC(CC)CCCl)OC.
What is the InChIKey of (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine?
The InChIKey is AJTFBSFRWBRGKS-FMIVXFBMSA-N. The full InChI is InChI=1S/C12H22ClNO/c1-5-11(7-8-13)14-12(6-2)9-10(3)15-4/h9,11,14H,3,5-8H2,1-2,4H3/b12-9+.
What are the key properties of (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine?
(3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine has a molecular weight of 231.77 g/mol, XLogP of 3.44, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-(1-chloropentan-3-yl)-5-methoxyhexa-3,5-dien-3-amine is sourced from PubChem (CID 134334193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).