C14H22N2O — CID 134334346
1-[4-[(2Z,4Z)-2-methylhepta-2,4,6-trienyl]piperazin-1-yl]ethanone (PubChem CID 134334346) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-[4-[(2Z,4Z)-2-methylhepta-2,4,6-trienyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[(2Z,4Z)-2-methylhepta-2,4,6-trienyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 134334346 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-[4-[(2Z,4Z)-2-methylhepta-2,4,6-trienyl]piperazin-1-yl]ethanone |
| SMILES | C=C/C=C\C=C(\C)CN1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C14H22N2O/c1-4-5-6-7-13(2)12-15-8-10-16(11-9-15)14(3)17/h4-7H,1,8-12H2,2-3H3/b6-5-,13-7- |
| InChIKey | WMZJOBMDVBLMAH-IGVOXHMPSA-N |
| XLogP | 1.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|