C32H26Br2N2O4 — CID 134334380
11,22-dibromo-7,18-di(butan-2-yl)-19-hydroxy-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17-trione (PubChem CID 134334380) has the molecular formula C32H26Br2N2O4 and a molecular weight of 662.38 g/mol. Its IUPAC name is 11,22-dibromo-7,18-di(butan-2-yl)-19-hydroxy-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17-trione.
| Compound Name | 11,22-dibromo-7,18-di(butan-2-yl)-19-hydroxy-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17-trione |
|---|---|
| PubChem CID | 134334380 |
| Molecular Formula | C32H26Br2N2O4 |
| Molecular Weight | 662.38 g/mol |
| Exact Mass | 660.03 |
| IUPAC Name | 11,22-dibromo-7,18-di(butan-2-yl)-19-hydroxy-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17-trione |
| SMILES | CCC(C)N1C(=O)c2ccc3c4c(Br)cc5c6c(ccc(c7c(Br)cc(c2c37)C1=O)c64)C(=O)N(C(C)CC)C5O |
| InChI | InChI=1S/C32H26Br2N2O4/c1-5-13(3)35-29(37)17-9-7-15-26-22(34)12-20-24-18(30(38)36(32(20)40)14(4)6-2)10-8-16(28(24)26)25-21(33)11-19(31(35)39)23(17)27(15)25/h7-14,31,39H,5-6H2,1-4H3 |
| InChIKey | YDVCFHSWBOHTDH-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.38 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|