C5H3IN4 — CID 134334464
3-iodo-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 134334464) has the molecular formula C5H3IN4 and a molecular weight of 246.01 g/mol. Its IUPAC name is 3-iodo-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | 3-iodo-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 134334464 |
| Molecular Formula | C5H3IN4 |
| Molecular Weight | 246.01 g/mol |
| Exact Mass | 245.94 |
| IUPAC Name | 3-iodo-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | Ic1nnc2ccncn12 |
| InChI | InChI=1S/C5H3IN4/c6-5-9-8-4-1-2-7-3-10(4)5/h1-3H |
| InChIKey | ZQNYZZGHICADCU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.01 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|