About 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine
2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine (PubChem CID 134334535) has the molecular formula C5H9N5
and a molecular weight of 139.16 g/mol. Its IUPAC name is 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine |
| PubChem CID | 134334535 |
| Molecular Formula | C5H9N5 |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine |
| SMILES | Cc1nc(N)n(/C=C\N)n1 |
| InChI | InChI=1S/C5H9N5/c1-4-8-5(7)10(9-4)3-2-6/h2-3H,6H2,1H3,(H2,7,8,9)/b3-2- |
| InChIKey | RQNZBSHCLYQJGR-IHWYPQMZSA-N |
| XLogP | -0.44 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine?
The IUPAC name of 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine (CID 134334535) is 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine?
The canonical SMILES for 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine is Cc1nc(N)n(/C=C\N)n1.
What is the InChIKey of 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine?
The InChIKey is RQNZBSHCLYQJGR-IHWYPQMZSA-N. The full InChI is InChI=1S/C5H9N5/c1-4-8-5(7)10(9-4)3-2-6/h2-3H,6H2,1H3,(H2,7,8,9)/b3-2-.
What are the key properties of 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine?
2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine has a molecular weight of 139.16 g/mol, XLogP of -0.44, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-2-aminoethenyl]-5-methyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 134334535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).