About (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine
(4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine (PubChem CID 134334623) has the molecular formula C6H11N5
and a molecular weight of 153.19 g/mol. Its IUPAC name is (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine |
| PubChem CID | 134334623 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine |
| SMILES | CNc1nc(=C/N)/c(=C\N)[nH]1 |
| InChI | InChI=1S/C6H11N5/c1-9-6-10-4(2-7)5(3-8)11-6/h2-3H,7-8H2,1H3,(H2,9,10,11)/b4-2+,5-3+ |
| InChIKey | PPEMEUMOCFFBPF-ZUVMSYQZSA-N |
| XLogP | -2.16 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine?
The IUPAC name of (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine (CID 134334623) is (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine.
What is the SMILES notation for (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine?
The canonical SMILES for (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine is CNc1nc(=C/N)/c(=C\N)[nH]1.
What is the InChIKey of (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine?
The InChIKey is PPEMEUMOCFFBPF-ZUVMSYQZSA-N. The full InChI is InChI=1S/C6H11N5/c1-9-6-10-4(2-7)5(3-8)11-6/h2-3H,7-8H2,1H3,(H2,9,10,11)/b4-2+,5-3+.
What are the key properties of (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine?
(4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine has a molecular weight of 153.19 g/mol, XLogP of -2.16, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4,5-bis(aminomethylidene)-N-methyl-1H-imidazol-2-amine is sourced from PubChem (CID 134334623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).