C11H16N2 — CID 134334691
(2Z,4Z)-2-ethenyl-3-N-ethylidene-1-N-methylhexa-2,4-diene-1,3-diimine (PubChem CID 134334691) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (2Z,4Z)-2-ethenyl-3-N-ethylidene-1-N-methylhexa-2,4-diene-1,3-diimine.
| Compound Name | (2Z,4Z)-2-ethenyl-3-N-ethylidene-1-N-methylhexa-2,4-diene-1,3-diimine |
|---|---|
| PubChem CID | 134334691 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (2Z,4Z)-2-ethenyl-3-N-ethylidene-1-N-methylhexa-2,4-diene-1,3-diimine |
| SMILES | C=CC(/C=N/C)=C(\C=C/C)/N=C/C |
| InChI | InChI=1S/C11H16N2/c1-5-8-11(13-7-3)10(6-2)9-12-4/h5-9H,2H2,1,3-4H3/b8-5-,11-10-,12-9+,13-7+ |
| InChIKey | AJLPATMVSZMWQR-CRRCWBTHSA-N |
| XLogP | 2.79 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|