About N'-but-1-en-2-ylheptane-1,7-diamine
N'-but-1-en-2-ylheptane-1,7-diamine (PubChem CID 134334701) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is N'-but-1-en-2-ylheptane-1,7-diamine.
Molecular Properties
| Compound Name | N'-but-1-en-2-ylheptane-1,7-diamine |
| PubChem CID | 134334701 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N'-but-1-en-2-ylheptane-1,7-diamine |
| SMILES | C=C(CC)NCCCCCCCN |
| InChI | InChI=1S/C11H24N2/c1-3-11(2)13-10-8-6-4-5-7-9-12/h13H,2-10,12H2,1H3 |
| InChIKey | RJCBCHLTQINDSN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-but-1-en-2-ylheptane-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-but-1-en-2-ylheptane-1,7-diamine?
The IUPAC name of N'-but-1-en-2-ylheptane-1,7-diamine (CID 134334701) is N'-but-1-en-2-ylheptane-1,7-diamine.
What is the SMILES notation for N'-but-1-en-2-ylheptane-1,7-diamine?
The canonical SMILES for N'-but-1-en-2-ylheptane-1,7-diamine is C=C(CC)NCCCCCCCN.
What is the InChIKey of N'-but-1-en-2-ylheptane-1,7-diamine?
The InChIKey is RJCBCHLTQINDSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2/c1-3-11(2)13-10-8-6-4-5-7-9-12/h13H,2-10,12H2,1H3.
What are the key properties of N'-but-1-en-2-ylheptane-1,7-diamine?
N'-but-1-en-2-ylheptane-1,7-diamine has a molecular weight of 184.33 g/mol, XLogP of 2.41, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-but-1-en-2-ylheptane-1,7-diamine is sourced from PubChem (CID 134334701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).