About 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne
1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne (PubChem CID 134335544) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne.
Molecular Properties
| Compound Name | 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne |
| PubChem CID | 134335544 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne |
| SMILES | CC(C)(C)OCC#CC#CCOC(C)(C)C |
| InChI | InChI=1S/C14H22O2/c1-13(2,3)15-11-9-7-8-10-12-16-14(4,5)6/h11-12H2,1-6H3 |
| InChIKey | VYUZXCVSDBCICK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne?
The IUPAC name of 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne (CID 134335544) is 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne.
What is the SMILES notation for 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne?
The canonical SMILES for 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne is CC(C)(C)OCC#CC#CCOC(C)(C)C.
What is the InChIKey of 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne?
The InChIKey is VYUZXCVSDBCICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-13(2,3)15-11-9-7-8-10-12-16-14(4,5)6/h11-12H2,1-6H3.
What are the key properties of 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne?
1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne has a molecular weight of 222.33 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diyne is sourced from PubChem (CID 134335544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).