C14H22N2O2 — CID 134335610
3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]oxy]cyclobutan-1-amine (PubChem CID 134335610) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]oxy]cyclobutan-1-amine.
| Compound Name | 3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]oxy]cyclobutan-1-amine |
|---|---|
| PubChem CID | 134335610 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]oxy]cyclobutan-1-amine |
| SMILES | CC(C)(C)COc1ccc(OC2CC(N)C2)nc1 |
| InChI | InChI=1S/C14H22N2O2/c1-14(2,3)9-17-11-4-5-13(16-8-11)18-12-6-10(15)7-12/h4-5,8,10,12H,6-7,9,15H2,1-3H3 |
| InChIKey | LTBQZTNGVLMDNW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |