C32H38N6O4 — CID 134335763
7-(3-hydroxynaphthalen-1-yl)-2-(3-piperidin-1-ylpropoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-5,6-dihydropyrido[3,4-d]pyrimidin-8-one (PubChem CID 134335763) has the molecular formula C32H38N6O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is 7-(3-hydroxynaphthalen-1-yl)-2-(3-piperidin-1-ylpropoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-5,6-dihydropyrido[3,4-d]pyrimidin-8-one.
| Compound Name | 7-(3-hydroxynaphthalen-1-yl)-2-(3-piperidin-1-ylpropoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-5,6-dihydropyrido[3,4-d]pyrimidin-8-one |
|---|---|
| PubChem CID | 134335763 |
| Molecular Formula | C32H38N6O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 7-(3-hydroxynaphthalen-1-yl)-2-(3-piperidin-1-ylpropoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-5,6-dihydropyrido[3,4-d]pyrimidin-8-one |
| SMILES | C=CC(=O)N1CCN(c2nc(OCCCN3CCCCC3)nc3c2CCN(c2cc(O)cc4ccccc24)C3=O)CC1 |
| InChI | InChI=1S/C32H38N6O4/c1-2-28(40)36-16-18-37(19-17-36)30-26-11-15-38(27-22-24(39)21-23-9-4-5-10-25(23)27)31(41)29(26)33-32(34-30)42-20-8-14-35-12-6-3-7-13-35/h2,4-5,9-10,21-22,39H,1,3,6-8,11-20H2 |
| InChIKey | WAHOBWQYCZAQKR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|