C16H18N2O2 — CID 13433695
3-methyl-2-oxo-1-phenyl-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-5-ium-4-olate (PubChem CID 13433695) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-methyl-2-oxo-1-phenyl-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-5-ium-4-olate.
| Compound Name | 3-methyl-2-oxo-1-phenyl-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-5-ium-4-olate |
|---|---|
| PubChem CID | 13433695 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-methyl-2-oxo-1-phenyl-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-5-ium-4-olate |
| SMILES | Cc1c([O-])[n+]2c(n(-c3ccccc3)c1=O)CCCCC2 |
| InChI | InChI=1S/C16H18N2O2/c1-12-15(19)17-11-7-3-6-10-14(17)18(16(12)20)13-8-4-2-5-9-13/h2,4-5,8-9H,3,6-7,10-11H2,1H3 |
| InChIKey | ZNXURKIGZRAVHO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|