About N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide
N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide (PubChem CID 134337122) has the molecular formula C10H10INO
and a molecular weight of 287.10 g/mol. Its IUPAC name is N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide.
Molecular Properties
| Compound Name | N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide |
| PubChem CID | 134337122 |
| Molecular Formula | C10H10INO |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide |
| SMILES | O=CNC1Cc2ccccc2C1I |
| InChI | InChI=1S/C10H10INO/c11-10-8-4-2-1-3-7(8)5-9(10)12-6-13/h1-4,6,9-10H,5H2,(H,12,13) |
| InChIKey | OIGVCPXRSSQXDW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide?
The IUPAC name of N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide (CID 134337122) is N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide.
What is the SMILES notation for N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide?
The canonical SMILES for N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide is O=CNC1Cc2ccccc2C1I.
What is the InChIKey of N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide?
The InChIKey is OIGVCPXRSSQXDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10INO/c11-10-8-4-2-1-3-7(8)5-9(10)12-6-13/h1-4,6,9-10H,5H2,(H,12,13).
What are the key properties of N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide?
N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide has a molecular weight of 287.10 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-iodo-2,3-dihydro-1H-inden-2-yl)formamide is sourced from PubChem (CID 134337122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).