C25H28F2N4O2 — CID 134337559
N-[[(1S,3Z,4R)-3-[2-(2,6-difluorophenyl)-2-iminoethylidene]-2-imino-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-N-ethyl-4-methyl-1,2-oxazole-3-carboxamide (PubChem CID 134337559) has the molecular formula C25H28F2N4O2 and a molecular weight of 454.52 g/mol. Its IUPAC name is N-[[(1S,3Z,4R)-3-[2-(2,6-difluorophenyl)-2-iminoethylidene]-2-imino-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-N-ethyl-4-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[[(1S,3Z,4R)-3-[2-(2,6-difluorophenyl)-2-iminoethylidene]-2-imino-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-N-ethyl-4-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 134337559 |
| Molecular Formula | C25H28F2N4O2 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-[[(1S,3Z,4R)-3-[2-(2,6-difluorophenyl)-2-iminoethylidene]-2-imino-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-N-ethyl-4-methyl-1,2-oxazole-3-carboxamide |
| SMILES | [H]/N=C(/C=C1C(=N/[H])\[C@@]2(CN(CC)C(=O)c3nocc3C)CC[C@@H]\1C2(C)C)c1c(F)cccc1F |
| InChI | InChI=1S/C25H28F2N4O2/c1-5-31(23(32)21-14(2)12-33-30-21)13-25-10-9-16(24(25,3)4)15(22(25)29)11-19(28)20-17(26)7-6-8-18(20)27/h6-8,11-12,16,28-29H,5,9-10,13H2,1-4H3/b15-11-,28-19-,29-22+/t16-,25-/m0/s1 |
| InChIKey | QJJYNKROJVFGAK-JGNVKIOISA-N |
| XLogP | 5.17 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|