About N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide
N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide (PubChem CID 134337608) has the molecular formula C9H11N5O
and a molecular weight of 205.22 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide |
| PubChem CID | 134337608 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide |
| SMILES | CC(=O)Nc1nn(C)c2cnc(C)nc12 |
| InChI | InChI=1S/C9H11N5O/c1-5-10-4-7-8(11-5)9(12-6(2)15)13-14(7)3/h4H,1-3H3,(H,12,13,15) |
| InChIKey | BLTUJMABNFIQGC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide?
The IUPAC name of N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide (CID 134337608) is N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide.
What is the SMILES notation for N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide?
The canonical SMILES for N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide is CC(=O)Nc1nn(C)c2cnc(C)nc12.
What is the InChIKey of N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide?
The InChIKey is BLTUJMABNFIQGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O/c1-5-10-4-7-8(11-5)9(12-6(2)15)13-14(7)3/h4H,1-3H3,(H,12,13,15).
What are the key properties of N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide?
N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide has a molecular weight of 205.22 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,5-dimethylpyrazolo[4,3-d]pyrimidin-3-yl)acetamide is sourced from PubChem (CID 134337608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).