About (E)-5,5-dihydroxypent-3-en-2-one
(E)-5,5-dihydroxypent-3-en-2-one (PubChem CID 13433791) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is (E)-5,5-dihydroxypent-3-en-2-one.
Molecular Properties
| Compound Name | (E)-5,5-dihydroxypent-3-en-2-one |
| PubChem CID | 13433791 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (E)-5,5-dihydroxypent-3-en-2-one |
| SMILES | CC(=O)/C=C/C(O)O |
| InChI | InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3,5,7-8H,1H3/b3-2+ |
| InChIKey | ZLPFXJFKMLTOQD-NSCUHMNNSA-N |
| XLogP | -0.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,5-dihydroxypent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,5-dihydroxypent-3-en-2-one?
The IUPAC name of (E)-5,5-dihydroxypent-3-en-2-one (CID 13433791) is (E)-5,5-dihydroxypent-3-en-2-one.
What is the SMILES notation for (E)-5,5-dihydroxypent-3-en-2-one?
The canonical SMILES for (E)-5,5-dihydroxypent-3-en-2-one is CC(=O)/C=C/C(O)O.
What is the InChIKey of (E)-5,5-dihydroxypent-3-en-2-one?
The InChIKey is ZLPFXJFKMLTOQD-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3,5,7-8H,1H3/b3-2+.
What are the key properties of (E)-5,5-dihydroxypent-3-en-2-one?
(E)-5,5-dihydroxypent-3-en-2-one has a molecular weight of 116.12 g/mol, XLogP of -0.56, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5-dihydroxypent-3-en-2-one is sourced from PubChem (CID 13433791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).