2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid

C8H13NO3 — CID 134338083

IUPAC2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid
SMILESCCC1(CC(=O)O)CC(C)=NO1
InChIInChI=1S/C8H13NO3/c1-3-8(5-7(10)11)4-6(2)9-12-8/h3-5H2,1-2H3,(H,10,11)
InChIKeyCXOVGZZYPKCQJG-UHFFFAOYSA-N
MW171.20 g/mol
LogP1.41
Rot. Bonds3

About 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid

2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid (PubChem CID 134338083) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid
PubChem CID134338083
Molecular FormulaC8H13NO3
Molecular Weight171.20 g/mol
Exact Mass171.09
IUPAC Name2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid
SMILESCCC1(CC(=O)O)CC(C)=NO1
InChIInChI=1S/C8H13NO3/c1-3-8(5-7(10)11)4-6(2)9-12-8/h3-5H2,1-2H3,(H,10,11)
InChIKeyCXOVGZZYPKCQJG-UHFFFAOYSA-N
XLogP1.41
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.20
LogP ≤ 51.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid?
The IUPAC name of 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid (CID 134338083) is 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid.
What is the SMILES notation for 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid?
The canonical SMILES for 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid is CCC1(CC(=O)O)CC(C)=NO1.
What is the InChIKey of 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid?
The InChIKey is CXOVGZZYPKCQJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-3-8(5-7(10)11)4-6(2)9-12-8/h3-5H2,1-2H3,(H,10,11).
What are the key properties of 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid?
2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid has a molecular weight of 171.20 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethyl-3-methyl-4H-1,2-oxazol-5-yl)acetic acid is sourced from PubChem (CID 134338083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).