C22H27FN5O7PS — CID 134338989
ethyl (2S)-2-[[[(2R,3R,4R,5S)-2-amino-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 134338989) has the molecular formula C22H27FN5O7PS and a molecular weight of 555.53 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5S)-2-amino-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-2-amino-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 134338989 |
| Molecular Formula | C22H27FN5O7PS |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-2-amino-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@@]1(N)O[C@@H](c2csc3c(N)ncnc23)[C@H](F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H27FN5O7PS/c1-3-32-21(30)12(2)28-36(31,35-13-7-5-4-6-8-13)33-10-22(25)19(29)15(23)17(34-22)14-9-37-18-16(14)26-11-27-20(18)24/h4-9,11-12,15,17,19,29H,3,10,25H2,1-2H3,(H,28,31)(H2,24,26,27)/t12-,15-,17-,19-,22+,36?/m0/s1 |
| InChIKey | MAXNOVKZPNEGOR-ZZIZOBCLSA-N |
| XLogP | 2.44 |
| TPSA | 181.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|