C29H57ClN8O — CID 134339799
2-amino-N-[3-butyl-4-(3,4-dimethylpiperazin-1-yl)piperidin-3-yl]-6-chloro-3a-heptan-3-yl-2,3,4,5,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 134339799) has the molecular formula C29H57ClN8O and a molecular weight of 569.28 g/mol. Its IUPAC name is 2-amino-N-[3-butyl-4-(3,4-dimethylpiperazin-1-yl)piperidin-3-yl]-6-chloro-3a-heptan-3-yl-2,3,4,5,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-N-[3-butyl-4-(3,4-dimethylpiperazin-1-yl)piperidin-3-yl]-6-chloro-3a-heptan-3-yl-2,3,4,5,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 134339799 |
| Molecular Formula | C29H57ClN8O |
| Molecular Weight | 569.28 g/mol |
| Exact Mass | 568.43 |
| IUPAC Name | 2-amino-N-[3-butyl-4-(3,4-dimethylpiperazin-1-yl)piperidin-3-yl]-6-chloro-3a-heptan-3-yl-2,3,4,5,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCCCC(CC)C12NCC(Cl)CN1NC(N)C2C(=O)NC1(CCCC)CNCCC1N1CCN(C)C(C)C1 |
| InChI | InChI=1S/C29H57ClN8O/c1-6-9-11-22(8-3)29-25(26(31)35-38(29)19-23(30)17-33-29)27(39)34-28(13-10-7-2)20-32-14-12-24(28)37-16-15-36(5)21(4)18-37/h21-26,32-33,35H,6-20,31H2,1-5H3,(H,34,39) |
| InChIKey | QGOTXBZBNFSGPF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|