C13H11N3O2Se — CID 13433991
6-ethyl-4-phenyl-[1,2]selenazolo[4,3-d]pyrimidine-5,7-dione (PubChem CID 13433991) has the molecular formula C13H11N3O2Se and a molecular weight of 320.21 g/mol. Its IUPAC name is 6-ethyl-4-phenyl-[1,2]selenazolo[4,3-d]pyrimidine-5,7-dione.
| Compound Name | 6-ethyl-4-phenyl-[1,2]selenazolo[4,3-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 13433991 |
| Molecular Formula | C13H11N3O2Se |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 6-ethyl-4-phenyl-[1,2]selenazolo[4,3-d]pyrimidine-5,7-dione |
| SMILES | CCn1c(=O)c2n[se]cc2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C13H11N3O2Se/c1-2-15-12(17)11-10(8-19-14-11)16(13(15)18)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | QIHRGPKNQFZHHW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|