C22H39FN4O — CID 134340116
2-(3-amino-1-cyclononyl-5-fluoropiperidin-4-yl)-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one (PubChem CID 134340116) has the molecular formula C22H39FN4O and a molecular weight of 394.58 g/mol. Its IUPAC name is 2-(3-amino-1-cyclononyl-5-fluoropiperidin-4-yl)-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one.
| Compound Name | 2-(3-amino-1-cyclononyl-5-fluoropiperidin-4-yl)-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 134340116 |
| Molecular Formula | C22H39FN4O |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 2-(3-amino-1-cyclononyl-5-fluoropiperidin-4-yl)-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one |
| SMILES | NC1CN(C2CCCCCCCC2)CC(F)C1N1CCN2C(=O)CCCC2C1 |
| InChI | InChI=1S/C22H39FN4O/c23-19-15-26(17-8-5-3-1-2-4-6-9-17)16-20(24)22(19)25-12-13-27-18(14-25)10-7-11-21(27)28/h17-20,22H,1-16,24H2 |
| InChIKey | AQKOPQHIGOKGCS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |