C27H36N4O5 — CID 134340527
methyl 7-[[(2Z,4Z)-2-formyl-3-methyl-5-(methylamino)hexa-2,4-dienyl]carbamoyl]-6-methyl-5-(1-morpholin-4-ylethyl)indolizine-2-carboxylate (PubChem CID 134340527) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is methyl 7-[[(2Z,4Z)-2-formyl-3-methyl-5-(methylamino)hexa-2,4-dienyl]carbamoyl]-6-methyl-5-(1-morpholin-4-ylethyl)indolizine-2-carboxylate.
| Compound Name | methyl 7-[[(2Z,4Z)-2-formyl-3-methyl-5-(methylamino)hexa-2,4-dienyl]carbamoyl]-6-methyl-5-(1-morpholin-4-ylethyl)indolizine-2-carboxylate |
|---|---|
| PubChem CID | 134340527 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | methyl 7-[[(2Z,4Z)-2-formyl-3-methyl-5-(methylamino)hexa-2,4-dienyl]carbamoyl]-6-methyl-5-(1-morpholin-4-ylethyl)indolizine-2-carboxylate |
| SMILES | CN/C(C)=C\C(C)=C(/C=O)CNC(=O)c1cc2cc(C(=O)OC)cn2c(C(C)N2CCOCC2)c1C |
| InChI | InChI=1S/C27H36N4O5/c1-17(11-18(2)28-5)22(16-32)14-29-26(33)24-13-23-12-21(27(34)35-6)15-31(23)25(19(24)3)20(4)30-7-9-36-10-8-30/h11-13,15-16,20,28H,7-10,14H2,1-6H3,(H,29,33)/b18-11-,22-17- |
| InChIKey | PBXCWVWXFHZFTQ-ROQOITEQSA-N |
| XLogP | 2.80 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|