About (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine
(3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine (PubChem CID 134340683) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine.
Molecular Properties
| Compound Name | (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine |
| PubChem CID | 134340683 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine |
| SMILES | C=CN/C(C(=C)N1CCOCC1)=C(/C)CC |
| InChI | InChI=1S/C13H22N2O/c1-5-11(3)13(14-6-2)12(4)15-7-9-16-10-8-15/h6,14H,2,4-5,7-10H2,1,3H3/b13-11- |
| InChIKey | QQEGTMIESRTBBF-QBFSEMIESA-N |
| XLogP | 2.25 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine?
The IUPAC name of (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine (CID 134340683) is (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine.
What is the SMILES notation for (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine?
The canonical SMILES for (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine is C=CN/C(C(=C)N1CCOCC1)=C(/C)CC.
What is the InChIKey of (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine?
The InChIKey is QQEGTMIESRTBBF-QBFSEMIESA-N. The full InChI is InChI=1S/C13H22N2O/c1-5-11(3)13(14-6-2)12(4)15-7-9-16-10-8-15/h6,14H,2,4-5,7-10H2,1,3H3/b13-11-.
What are the key properties of (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine?
(3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine has a molecular weight of 222.33 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N-ethenyl-4-methyl-2-morpholin-4-ylhexa-1,3-dien-3-amine is sourced from PubChem (CID 134340683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).